4-Nitrobenzyl alcohol (4-Nitrobenzenemathanol) | MedChemExpress (MCE)
4-Nitrobenzyl alcohol (4-Nitrobenzenemathanol) is a nitro compound used as a reactant in drug synthesis. 4-Nitrobenzyl alcohol can be catalyzed to 4-nitrobenzaldehyde by the enzyme encoded by the benzyl alcohol dehydrogenase gene (ntnD)[1].
| Trivial name | 4-Nitrobenzyl alcohol (4-Nitrobenzenemathanol) |
| Catalog Number | HY-W015570 |
| Alternative Name(s) | 4-Nitrobenzenemathanol; 4-Nitrobenzyl alcohol |
| Research Area | Others |
| CAS# | 619-73-8 |
| Purity | ≥98.0% |
| SMILES | OCC1=CC=C([N+]([O-])=O)C=C1 |
| Size | 25 g |
| Supplier Page | https://www.medchemexpress.com/4-nitrobenzyl-alcohol-4-nitrobenzenemathanol.html |