H-Ala-Ala-OH (L-Alanyl-L-alanine; Ala-Ala) | MedChemExpress (MCE)
H-Ala-Ala-OH (L-Alanyl-L-alanine; Ala-Ala) is a nonpolar dipeptide that is absorbed by human intestinal Caco-2 cells. The transport of alanine (Ala), like proton/amino acid symport, can lead to cytoplasmic acidification[1].
| Trivial name | H-Ala-Ala-OH (L-Alanyl-L-alanine; Ala-Ala) |
| Catalog Number | HY-W010162 |
| Alternative Name(s) | L-Alanyl-L-alanine; Ala-Ala |
| Research Area | Others |
| CAS# | 1948-31-8 |
| Purity | ≥98.0% |
| SMILES | C[C@@H](C(O)=O)NC([C@H](C)N)=O |
| Size | 100 mg |
| Supplier Page | https://www.medchemexpress.com/h-ala-ala-oh-l-alanyl-l-alanine-ala-ala.html |