TrxR1-IN-B19 | MedChemExpress (MCE)
TrxR1-IN-B19 (GO-Y015) (Compound B19) is a Curcumin (HY-N0005) derivative and colvalent TrxR1 inhibitor. TrxR1-IN-B19 inhibits TrxR1 enzyme activity to elevate oxidative stress, and then induce ROS-mediated ER Stress and mitochondrial dysfunction, subsequently resulting in cell cycle arrest and apoptosis[1].
| Trivial name | TrxR1-IN-B19 |
| Catalog Number | HY-120914 |
| Alternative Name(s) | GO-Y015 |
| Research Area | Cancer |
| CAS# | 170950-29-5 |
| Purity | ≥98.0% |
| SMILES | COC(C(OC)=CC=C1)=C1/C=C/C(/C=C/C2=C(C(OC)=CC=C2)OC)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/trxr1-in-b19.html |