Leminoprazole | MedChemExpress (MCE)
Leminoprazole (NC 1300O3) is an inhibitor for acid pump, H+ K+-ATPase,. Leminoprazole stimulates the secretion and synthesis of gastric mucus, attenuates gastric ulcers. Leminoprazole is orally active[1][2][3].
| Trivial name | Leminoprazole |
| Catalog Number | HY-105094 |
| Alternative Name(s) | NC 1300O3 |
| Research Area | Inflammation/Immunology |
| CAS# | 104340-86-5 |
| Purity | ≥98.0% |
| SMILES | CC(CN(C1=C(CS(C2=NC3=C(N2)C=CC=C3)=O)C=CC=C1)C)C |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/leminoprazole.html |