Namirotene | MedChemExpress (MCE)
Namirotene (CBS-211A) is a retinoic acid analog, which is utilized in topical eye administration. Namirotene enhances 1α,25-dihydroxyvitamin D3-induced cytotoxicity in cell U937 and induces the differentation in U937[1].
| Trivial name | Namirotene |
| Catalog Number | HY-101556 |
| Alternative Name(s) | CBS-211A |
| Research Area | Cancer |
| CAS# | 101506-83-6 |
| Purity | ≥98.0% |
| SMILES | O=C(O)C1=CC=C(/C=C(C2=CC=C(C(C)C)S2)\C)C=C1 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/namirotene.html |