L-Thyroxine sodium xhydrate | MedChemExpress (MCE)
L-Thyroxine sodium xhydrate (Levothyroxine; T4) is a synthetic hormone in the treatment of hypothyroidism. DIO enzymes convert biologically active hormone (Triiodothyronine,T3) from L-Thyroxine (T4).
| Trivial name | L-Thyroxine sodium xhydrate |
| Catalog Number | HY-W010669 |
| Alternative Name(s) | Sodium levothyroxine |
| Research Area | Endocrinology |
| CAS# | 25416-65-3 |
| Purity | ≥98.0% |
| SMILES | IC1=C(O)C(I)=CC(OC2=C(I)C=C(C[C@@](N)([H])C(O[Na])=O)C=C2I)=C1.O |
| Size | 1 g |
| Supplier Page | https://www.medchemexpress.com/L-Thyroxine_sodium_xhydrate.html |