RTx-152 | MedChemExpress (MCE)
RTx-152 traps Polθ on DNA and is an allosteric Polθ-pol inhibitor (IC50: 6.2 nM). RTx-152 selectively kills HR-deficient cancer cells, and suppresses PARP inhibitor resistance in multiple genetic backgrounds, including homologous recombination (HR)-proficient cells. RTx-152 selectively kills BRCA2-null cells[1].
| Trivial name | RTx-152 |
| Catalog Number | HY-161431 |
| Research Area | Cancer |
| Purity | ≥98.0% |
| SMILES | FC(F)(F)C1=CC(N2CCN(C)C2=O)=C(OC(N(C3=CC=C(F)C=C3)C)=O)C(C(F)(F)F)=C1 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/rtx-152.html |