Motilin, human, porcine | MedChemExpress (MCE)
Motilin, human, porcine is a gastrointestinal hormone, which is released during fasting and after eating, or by drinking water. Motilin, human, porcine promotes enteric cholinergic activity in human stomach with an EC50 of 33 nM, and thus modulates gastrointestinal motility function[1].
| Trivial name | Motilin, human, porcine |
| Catalog Number | HY-P3176 |
| Research Area | Others |
| CAS# | 9072-41-7 |
| Purity | ≥98.0% |
| SMILES | N[C@@H](CC1=CC=CC=C1)C(N[C@@H](C(C)C)C(N2[C@@H](CCC2)C(N[C@@H]([C@@H](C)CC)C(N[C@H](C(N[C@@H]([C@H](O)C)C(N[C@H](C(NCC(N[C@@H](CCC(O)=O)C(N[C@@H](CC(C)C)C(N[C@@H](CCC(N)=O)C(N[C@@H](CCCNC(N)=N)C(N[C@@H](CCSC)C(N[C@@H](CCC(N)=O)C(N[C@@H](CCC(O)=O)C(N[C@@H](CCCCN)C(N[C@@H](CCC(O)=O)C(N[C@@H](CCCNC(N)=N)C(N[C@@H](CC(N)=O)C(N[C@@H](CCCCN)C(NCC(N[C@H](C(O)=O)CCC(N)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)CC3=CC=C(C=C3)O)=O)=O)CC4=CC=CC=C4)=O)=O)=O)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/motilin-human-porcine.html |