5-Hydroxymethyl uridine | MedChemExpress (MCE)
5-Hydroxymethyl uridine is a thymidine analogue. Analogs of this series have insertional activity towards replicated DNA. They can be used to label cells and track DNA synthesis[1].
| Trivial name | 5-Hydroxymethyl uridine |
| Catalog Number | HY-W394106 |
| Research Area | Others |
| CAS# | 30414-00-7 |
| Purity | ≥98.0% |
| SMILES | O[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1N2C(NC(C(CO)=C2)=O)=O |
| Size | 100 mg |
| Supplier Page | https://www.medchemexpress.com/5-hydroxymethyl-uridine.html |