HaloFlipper 30 | MedChemExpress (MCE)
HaloFlipper 30 is a fluorescent probe that covalently reacts with HaloTag fusion proteins to form an ester bond, which allows the probe to be stably attached to membrane structures. HaloFlipper 30 has high specificity, precision and good cell permeability[1].
| Trivial name | HaloFlipper 30 |
| Catalog Number | HY-D2317 |
| Research Area | Others |
| Purity | ≥98.0% |
| SMILES | CC1=C(C#N)SC(C2=C3C(C)=C(C4=C(C)C(SC5=C6SC(COCC7=CN(CCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCC(NCCOCCOCCCCCCCl)=O)N=N7)=C5C)=C6S4)S2)=C1S3(=O)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/haloflipper-30.html |