EBOV-IN-7 | MedChemExpress (MCE)
EBOV-IN-7 (compound 26) is an inhibitor of the Ebola virus EBOV with an IC50 of 2.04 μM against EBOV-GP pseudotyped virus (pEBOV). EBOV-IN-7 has inhibitory effects on cancer cells and inhibits the EBOV-GPcl/NPC1 interaction.[8][1].
| Trivial name | EBOV-IN-7 |
| Catalog Number | HY-160882 |
| Research Area | Infection |
| CAS# | 68207-16-9 |
| Purity | ≥98.0% |
| SMILES | O=C(NNC1=CC=CC=C1SC2=CC(Cl)=CC=C2[N+]([O-])=O)CN3CCCC3 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/ebov-in-7.html |