Tiflucarbine | MedChemExpress (MCE)
Tiflucarbine (BAY-P 4495) is a tetrahydrothieno-7-carboline derivative. Tiflucarbine is a potent antidepressant agent that binds at central serotonin (5-HT) binding sites. Tiflucarbine is a nonselective 5-HT (5-HT1 and 5-HT2) agonist[1][2].
| Trivial name | Tiflucarbine |
| Catalog Number | HY-106484 |
| Alternative Name(s) | BAY-P 4495 |
| Research Area | Neurological Disease |
| CAS# | 89875-86-5 |
| Purity | ≥98.0% |
| SMILES | FC1=C(SC=C2C)C2=C3C(CN(CC4)CC)=C4NC3=C1 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/tiflucarbine.html |