4,4′-Sulfonyldiphenol | MedChemExpress (MCE)
4,4′-Sulfonyldiphenol (Bisphenol S; Bis(4-hydroxyphenyl) sulfone) is a biochemical reagent that can be used as a biological material or organic compound for life science related research[1].
| Trivial name | 4,4'-Sulfonyldiphenol |
| Catalog Number | HY-W011927 |
| Alternative Name(s) | Bisphenol S; Bis(4-hydroxyphenyl) sulfone |
| Research Area | Others |
| CAS# | 80-09-1 |
| Purity | ≥98.0% |
| SMILES | O=S(C1=CC=C(O)C=C1)(C2=CC=C(O)C=C2)=O |
| Size | 100 g |
| Supplier Page | https://www.medchemexpress.com/4-4-sulfonyldiphenol.html |