Antidiabetic agent 5 | MedChemExpress (MCE)
Antidiabetic agent 5 (compound S1) is a antidiabetic agent. Antidiabetic agent 5 inhibits the activity of α-glucosidase and α-amylase with IC50 values of 3.91, 8.89 µM, respectively. Antidiabetic agent 5 decreases sugar levels. Antidiabetic agent 5 has the potential for the research of type-II diabetes[1].
| Trivial name | Antidiabetic agent 5 |
| Catalog Number | HY-161429 |
| Research Area | Metabolic Disease |
| CAS# | 2152667-21-3 |
| Purity | ≥98.0% |
| SMILES | OC1=C(C(N/N=C(C2=CC=CC=C2)\C)=O)NS(C3=CC=CC=C31)(=O)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/antidiabetic-agent-5.html |