Lenalidomide nonanedioic acid | MedChemExpress (MCE)
Lenalidomide nonanedioic acid is a conjugate of the E3 ligase ligand and linker of LHF418 (HY-161450). Lenalidomide nonanedioic acid can be used as a key intermediate for the synthesis of intact PROTACs molecules[1].
| Trivial name | Lenalidomide nonanedioic acid |
| Catalog Number | HY-161451 |
| Research Area | Cancer |
| Purity | ≥98.0% |
| SMILES | O=C(O)CCCCCCCC(NC1=C2C(C(N(C3CCC(NC3=O)=O)C2)=O)=CC=C1)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/lenalidomide-nonanedioic-acid.html |