YSK 12C4 | MedChemExpress (MCE)
YSK 12C4 is an ionizable cationic lipid primarily used to enhance siRNA cellular delivery via multifunctional envelope-type nanodevices (MEND). YSK 12C4 promotes siRNA uptake and endosomal escape, effectively silencing genes in human immune cell lines[1].
| Trivial name | YSK 12C4 |
| Catalog Number | HY-160852 |
| Research Area | Inflammation/Immunology |
| CAS# | 1829511-70-7 |
| Purity | ≥98.0% |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC(CCCCN(C)C)(O)CCCCCCCC/C=C\C/C=C\CCCCC |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/ysk-12c4.html |