4F-DDC | MedChemExpress (MCE)
4F-DDC is a novel PARP1 inhibitor with an IC50 value of 82 nM. 4F-DDC induces DNA damage and activates the cGAS–STING pathway. 4F-DDC inhibits the growth of HCC-1937-derived tumor xenografts[1].
| Trivial name | 4F-DDC |
| Catalog Number | HY-163461 |
| Research Area | Cancer |
| Purity | ≥98.0% |
| SMILES | S=C(N/N=C/C1=CC(OC)=C(OC)C(Br)=C1Br)NC2=CC=C(F)C=C2 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/4f-ddc.html |