2-O-trans-p-Coumaroylalphitolic acid | MedChemExpress (MCE)
2-O-trans-p-Coumaroylalphitolic acid (Zj7) is a triterpene which can be extracted from jujube plants. 2-O-trans-P-Coumaroyl alphitolic acid is a selective modulator of glucocorticoid receptor (GR). 2-O-trans-P-coumaroyl alphitolic acid can be used in the study of obesity[1].
| Trivial name | 2-O-trans-p-Coumaroylalphitolic acid |
| Catalog Number | HY-N12744 |
| Research Area | Metabolic Disease |
| CAS# | 67911-63-1 |
| Purity | ≥98.0% |
| SMILES | [H][C@]12CC[C@@]3([C@]4([C@@H](CC[C@@]4(CC[C@]3([C@@]1(CC[C@]5(C(C)([C@H]([C@@H](C[C@]25C)OC(/C=C/C6=CC=C(C=C6)O)=O)O)C)[H])C)C)C(O)=O)C(C)=C)[H])[H] |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/2-o-trans-p-coumaroylalphitolic-acid.html |