Debrisoquin hydroiodide | MedChemExpress (MCE)
Debrisoquin (hydroiodide) is the hydrochloride form of Debrisoquin (HY-B1624). Debrisoquin is a TMPRSS2 inhibitors that inhibits SARS-CoV-2 entry into human lung cell line by a TMPRSS2-depedent manner. Debrisoquin can be used for antiviral research[1].
| Trivial name | Debrisoquin hydroiodide |
| Catalog Number | HY-W195509 |
| Alternative Name(s) | Debrisoquine hydroiodide; Isocaramidine hydroiodide; Ro 5-3307/1 hydroiodide |
| Research Area | Infection |
| CAS# | 1052540-65-4 |
| Purity | ≥98.0% |
| SMILES | N=C(N1CC2=C(CC1)C=CC=C2)N.I |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/debrisoquin-hydroiodide.html |