WRN inhibitor 7 | MedChemExpress (MCE)
WRN inhibitor 7 (Compound h6) is a WRN inhibitor. WRN inhibitor 7 effectively inhibits WRN’s helicase and ATPase activity (IC50: 9.8 μM and 15.8 μM respectively). WRN inhibitor 7 can be used for research of microsatellite instable (MSI) cancers[1].
| Trivial name | WRN inhibitor 7 |
| Catalog Number | HY-161386 |
| Research Area | Cancer |
| CAS# | 444780-45-4 |
| Purity | ≥98.0% |
| SMILES | O=C(N/1)N(CC(NC2=CC=C(C)C=C2)=O)C(C1=C/C3=C(OCC4=CC(C(O)=O)=CC=C4)C=CC=C3)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/wrn-inhibitor-7.html |