Rhod-5N | MedChemExpress (MCE)
Rhod-5N is a calcium-binding fluorescent dye composed of a BAPTA chelating group and a rhodamine fluorophore. Rhod-5N is often added to MOPS buffer to complex and indicate cation content. The selectivity of Rhod-5N for Cd2+ is higher than other interfering cations ((Na+, K+, Mg2+, Ca2+, Zn2+) except Pb2+), and the detection limit is 3.1 μg/L[1][2].
| Trivial name | Rhod-5N |
| Catalog Number | HY-136894 |
| Research Area | Others |
| CAS# | 888229-31-0 |
| Purity | ≥98.0% |
| SMILES | CN(C1=CC2=C(C=C1)C(C(C=C3)=CC(OCCOC(C=C4[N+]([O-])=O)=C(C=C4)N(CC(O[K])=O)CC(O[K])=O)=C3N(CC(O[K])=O)CC([O-])=O)=C(C=CC(N(C)C)=C5)C5=[O+]2)C |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/rhod-5n.html |