Triapine hydrochloride | MedChemExpress (MCE)
Triapine (hydrochloride) is the hydrochloride form of Triapine (HY-10082). Triapine (3-AP; PAN-811) is a potent inhibitor of the M2 subunit of ribonucleotide reductase (RR), and is a potent radiosensitizer[1].
| Trivial name | Triapine hydrochloride |
| Catalog Number | HY-10082B |
| Alternative Name(s) | 3-AP hydrochloride; PAN-811 hydrochloride; OCX191 hydrochloride |
| Research Area | Cancer |
| CAS# | 216240-62-9 |
| Purity | ≥98.0% |
| SMILES | S=C(N)N/N=C/C1=NC=CC=C1N.[H]Cl |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/triapine-hydrochloride.html |