Hymenoxin | MedChemExpress (MCE)
Hymenoxin (compound 7) is a dual inhibitor of iNOS and NF-κB with IC50 of 42.7 μM and 85.5 μM respectively. Hymenoxin can inhibit 16% of oxidative stress at a concentration of 125 μg/mL[1].
| Trivial name | Hymenoxin |
| Catalog Number | HY-N12735 |
| Research Area | Others |
| CAS# | 56003-01-1 |
| Purity | ≥98.0% |
| SMILES | O=C1C=C(C2=CC(OC)=C(OC)C=C2)OC3=C1C(O)=C(OC)C(O)=C3OC |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/hymenoxin.html |