Desloratadine-d4 hydrobromide | MedChemExpress (MCE)
Desloratadine-d4 hydrobromide is deuterated labeled Desloratadine (HY-B0539). Desloratadine (Sch34117) is the orally active major metabolite of the nonsedating H1-antihistamine Loratadine. Desloratadine is a selective H1-receptor antagonist that has anti-allergic and anti-inflammatory activities[1][2].
| Trivial name | Desloratadine-d4 hydrobromide |
| Catalog Number | HY-B0539S4 |
| Alternative Name(s) | Sch34117-d4 hydrobromide |
| Research Area | Inflammation/Immunology; Endocrinology; Cancer |
| Purity | ≥98.0% |
| SMILES | [2H]C(NC([2H])C/1[2H])C([2H])C1=C2C3=CC=C(Cl)C=C3CCC4=CC=CN=C4\2.Br |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/desloratadine-d4-hydrobromide.html |