Cy7 DiAcid | MedChemExpress (MCE)
Cy7 DiAcid belongs to the cyanine dye series and is a common fluorescent marker for biomolecules that can interact with biomolecules. Cyanine dyes may also bind to double-helical DNA through intercalation and exhibit enhanced fluorescence upon binding.
| Trivial name | Cy7 DiAcid |
| Catalog Number | HY-D1095 |
| CAS# | 1268616-88-1 |
| Purity | ≥98.0% |
| SMILES | CC1(C)C(/C=C/C=C/C=C/C=C2N(CCCCCC(O)=O)C3=C(C=CC=C3)C\2(C)C)=[N+](CCCCCC(O)=O)C4=C1C=CC=C4.[Br-] |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/cy7-diacid.html |