Acid blue 260 | MedChemExpress (MCE)
Acid blue 260 is an azo dye whose staining effect is effectively removed by multi-walled carbon nanotubes (MWCNTs). At 298 K, the adsorption capacity of MWCNT is 233.34 mg/g; and increases with the increase of dye concentration and temperature.
| Trivial name | Acid blue 260 |
| Catalog Number | HY-D1144 |
| CAS# | 67827-60-5 |
| Purity | ≥98.0% |
| SMILES | O=S(C(C(N)=C1C2=O)=CC(NC3=C(C)C=C(C)C(CNC(C4=CC=CC=C4)=O)=C3C)=C1C(C5=C2C=CC=C5)=O)(O[Na])=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/acid-blue-260.html |