Cyanine5.5 NHS ester tetrafluoroborate | MedChemExpress (MCE)
Cyanine5.5 NHS ester tetrafluoroborate belongs to the cyanine dye series and is a common fluorescent marker for biomolecules that can interact with biomolecules. Cyanine dyes may also bind to double-helical DNA through intercalation and exhibit enhanced fluorescence upon binding.
| Trivial name | Cyanine5.5 NHS ester tetrafluoroborate |
| Catalog Number | HY-D1322 |
| CAS# | 2375105-86-3 |
| Purity | ≥98.0% |
| SMILES | O=C(CCCCCN1C2=C(C(C)(C)/C1=C\C=C\C=C\C3=[N+](C)C4=C(C3(C)C)C5=C(C=CC=C5)C=C4)C6=C(C=CC=C6)C=C2)ON7C(CCC7=O)=O.[F-][B+3]([F-])([F-])[F-] |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/cyanine5-5-nhs-ester-tetrafluoroborate.html |