Cyanine7 hydrazide dichloride | MedChemExpress (MCE)
Cyanine7 hydrazide dichloride belongs to the cyanine dye series and is a common fluorescent marker for biomolecules that can interact with biomolecules. Cyanine dyes may also bind to double-helical DNA through intercalation and exhibit enhanced fluorescence upon binding.
| Trivial name | Cyanine7 hydrazide dichloride |
| Catalog Number | HY-D1339 |
| CAS# | 2183440-63-1 |
| Purity | ≥98.0% |
| SMILES | O=C(CCCCC[N+]1=C(/C=C/C2=C/C(CCC2)=C/C=C3N(C)C4=C(C\3(C)C)C=CC=C4)C(C)(C)C5=C1C=CC=C5)N[NH3+].[Cl-].[Cl-] |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/cyanine7-hydrazide-dichloride.html |