DMNPE-caged D-luciferin | MedChemExpress (MCE)
DMNPE-caged D-luciferin is a heterocyclic luminescent compound that is a natural ligand for luciferase, an enzyme used to detect cell activity. Its reaction requires ATP and emits yellow-green light with a peak wavelength of about 530 nm. The luciferin in the DMNPE cage easily crosses the cell membrane.

Trivial name | DMNPE-caged D-luciferin |
Catalog Number | HY-D1343 |
CAS# | 223920-67-0 |
Purity | ≥98.0% |
SMILES | CC(OC([C@@H]1N=C(C2=NC3=CC=C(O)C=C3S2)SC1)=O)C4=C([N+]([O-])=O)C=C(OC)C(OC)=C4 |
Size | 1 mg |
Supplier Page | https://www.medchemexpress.com/dmnpe-caged-d-luciferin.html |