Eslicarbazepine acetate-d4 | MedChemExpress (MCE)
Eslicarbazepine acetate-d4 is deuterated labeled Eslicarbazepine acetate (HY-B0703). Eslicarbazepine acetate (BIA 2-093), an antiepileptic agent, is a dual a dual Inhibitor of β-Secretase and voltage-gated sodium channel.
| Trivial name | Eslicarbazepine acetate-d4 |
| Catalog Number | HY-B0703S |
| Alternative Name(s) | BIA 2-093-d4 |
| Research Area | Neurological Disease |
| Purity | ≥98.0% |
| SMILES | O=C(N1C2=CC=CC=C2C[C@H](OC(C)=O)C3=C([2H])C([2H])=C([2H])C([2H])=C31)N |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/eslicarbazepine-acetate-d4.html |