9-Ethylcarbazole | MedChemExpress (MCE)
9-Ethylcarbazole (N-Ethylcarbazole) serves as a hydrogen storage material. The introduction of nitrogen (N) into 9-ethylcarbazole can reduce the endothermic nature of the reaction and decrease the dehydrogenation temperature, thereby facilitating the process of hydrogen storage and release[1].
Trivial name | 9-Ethylcarbazole |
Catalog Number | HY-W015003 |
Alternative Name(s) | N-Ethylcarbazole |
Research Area | Others |
CAS# | 86-28-2 |
Purity | ≥98.0% |
SMILES | CCN1C2=C(C3=C1C=CC=C3)C=CC=C2 |
Size | 100 g |
Supplier Page | https://www.medchemexpress.com/9-ethylcarbazole.html |