Antibacterial agent 205 | MedChemExpress (MCE)
Antibacterial agent 205 (Compound 10d) is a indolylacryloyl-derived oxacins, which exhibits broad antibacterial spectrum with MIC of 0.25-0.5 μg/mL. Antibacterial agent 205 reduces the exopolysaccharide, eliminates the biofilm, and thus attenuates the drug resistance. Antibacterial agent 205 exhibits antibacterial activity through destory of membrane integrity, accumulation of reactive oxygen species ROS, and inhibition of DNA replication[1].
| Trivial name | Antibacterial agent 205 |
| Catalog Number | HY-162429 |
| Research Area | Infection |
| Purity | ≥98.0% |
| SMILES | O=C(N1CCN(C2=C(F)C=C3C(N(CC)C=C(C(O)=O)C3=O)=C2)CC1)/C(C#N)=C/C4=CN(CC(OCC)=O)C5=C4C=CC=C5 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/antibacterial-agent-205.html |