U-51605 | MedChemExpress (MCE)
U-51605 is a platelet aggregation inhibitor and inhibits thromboxane synthesis. U-51605 is also a prostaglandin I2 synthase inhibitor and can inhibit the retinal vasodilation response induced by NO donors (such as NOR3)[1][2].
| Trivial name | U-51605 |
| Catalog Number | HY-129199 |
| Research Area | Cardiovascular Disease |
| CAS# | 64192-56-9 |
| Purity | ≥98.0% |
| SMILES | OC(CCC/C=C\C[C@@H]1[C@H]([C@@]2([H])C[C@]1([H])N=N2)/C=C/CCCCCC)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/u-51605.html |