ABCG2-IN-3 | MedChemExpress (MCE)
ABCG2-IN-3 (Compound 52) is a selective inhibitor for breast cancer resistance protein (ABCG2), with an IC50 of 0.238 µM. ABCG2-IN-3 reverses the ABCG2-mediated resistance toward SN-38 and inhibit the ATPase activity[1].
| Trivial name | ABCG2-IN-3 |
| Catalog Number | HY-119724 |
| Research Area | Cancer |
| CAS# | 1942919-63-2 |
| Purity | ≥98.0% |
| SMILES | COC1=CC=C(C=C1)C(N2C(C3=C(CC2)C(C=CC=C4)=C4N3)C5=CC(Cl)=C(C=C5)Cl)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/abcg2-in-3.html |