Tropaeolin O | MedChemExpress (MCE)
Tropaeolin O is an acidic monoazo dye that undergoes a coupling reaction under pH=10.5 conditions to form a blue disazo dye. Tropaeolin O can be used for the determination of palladium(II), osmium(IV), albumin, and casein[1].
| Trivial name | Tropaeolin O |
| Catalog Number | HY-D0305 |
| Research Area | Others |
| CAS# | 547-57-9 |
| Purity | ≥98.0% |
| SMILES | O=S(C1=CC=C(/N=N/C2=CC=C(O)C=C2O)C=C1)(O[Na])=O |
| Size | 5 g |
| Supplier Page | https://www.medchemexpress.com/tropaeolin-o.html |