Tropaeolin O | MedChemExpress (MCE)
Tropaeolin O is an acidic monoazo dye that undergoes a coupling reaction under pH=10.5 conditions to form a blue disazo dye. Tropaeolin O can be used for the determination of palladium(II), osmium(IV), albumin, and casein[1].

Trivial name | Tropaeolin O |
Catalog Number | HY-D0305 |
Research Area | Others |
CAS# | 547-57-9 |
Purity | ≥98.0% |
SMILES | O=S(C1=CC=C(/N=N/C2=CC=C(O)C=C2O)C=C1)(O[Na])=O |
Size | 5 g |
Supplier Page | https://www.medchemexpress.com/tropaeolin-o.html |