NLRP3-IN-33 | MedChemExpress (MCE)
NLRP3-IN-33 (Compound 12o) is a blood-brain barrier permeable inhibitor of AChE and BChE, with IC50 values of 1.02 μM and 7.03 μM against hAChE and hBChE respectively. NLRP3-IN-33 possesses antioxidant, anti-inflammatory, and metal chelating activities, making it a potential candidate for research in Alzheimer’s disease (AD)[1].
| Trivial name | NLRP3-IN-33 |
| Catalog Number | HY-162402 |
| Research Area | Cancer |
| Purity | ≥98.0% |
| SMILES | O=C(NCC(NC1=C2C=CC=NC2=C(O)C=C1)=O)/C=C/C3=CC=C(O)C(OC)=C3 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/nlrp3-in-33.html |