GLI1-IN-1 | MedChemExpress (MCE)
GLI1-IN-1 (CBC-1) is a GLI-1 inhibitor with excellent water solubility and anticancer activity. GLI1-IN-1 can induce apoptosis and suppress the growth of colorectal cancer by inhibiting the Hedgehog(HH) (IC50=1.3 μM) pathway[1].
| Trivial name | GLI1-IN-1 |
| Catalog Number | HY-161459 |
| Research Area | Cancer |
| CAS# | 2923907-92-8 |
| Purity | ≥98.0% |
| SMILES | CN1CCN(CC(O[C@@H]2CC3=CC[C@]([C@](CC[C@@]4(O)[C@@H](OC([C@@H](C)CC)=O)C)(O)[C@]4(C)[C@H](OC(/C=C/C5=CC=CC=C5)=O)C6)(O)C6[C@@]3(C)CC2)=O)CC1 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/gli1-in-1.html |