3-O-Methylellagic acid-4′-O-α-L-rhamnopyranoside | MedChemExpress (MCE)
3-O-Methylellagic acid-4′-O-α-L-rhamnopyranoside is an ellagic acid glycoside compound that can be isolated from the stem bark of Aphananthe aspera and can be used for the research of inflammation and pain[1].
| Trivial name | 3-O-Methylellagic acid-4′-O-α-L-rhamnopyranoside |
| Catalog Number | HY-N12694 |
| Research Area | Inflammation/Immunology |
| CAS# | 51768-39-9 |
| Purity | ≥98.0% |
| SMILES | COC(C1=C2C3=C(O4)C(O)=C(O[C@H]5[C@@H]([C@@H]([C@H]([C@@H](O5)C)O)O)O)C=C3C(O1)=O)=C(O)C=C2C4=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/3-o-methylellagic-acid-4-o-α-l-rhamnopyranoside.html |