4′-Nitroacetophenone | MedChemExpress (MCE)
4′-Nitroacetophenone is a nitro-aromatic compound that is an intermediate of the pharmaceutical chloramphenicol and a dye intermediate that can be used in the manufacture of synthomycin and chloramphenicol[1].
| Trivial name | 4'-Nitroacetophenone |
| Catalog Number | HY-Y0185 |
| Research Area | Others |
| CAS# | 100-19-6 |
| Purity | 99.3% |
| SMILES | CC(C1=CC=C([N+]([O-])=O)C=C1)=O |
| Size | 25 g |
| Supplier Page | https://www.medchemexpress.com/4-nitroacetophenone.html |