Naloxegol oxalate | MedChemExpress (MCE)
Naloxegol oxalate (NKTR-118 oxalate; AZ-13337019 oxalate) is a μ-opioid-receptor antagonist. Naloxegol oxalate inhibits opioid binding in μ-opioid receptors in the gastrointestinal tract and effective for alleviating opioid-induced constipation[1][2].
| Trivial name | Naloxegol oxalate |
| Catalog Number | HY-A0118A |
| Alternative Name(s) | NKTR-118 oxalate; AZ-13337019 oxalate |
| Research Area | Neurological Disease |
| CAS# | 1354744-91-4 |
| Purity | 99.9% |
| SMILES | O[C@@]1(CC[C@H](OCCOCCOCCOCCOCCOCCOCCOC)[C@]2([H])OC3=C4O)[C@]52C3=C(C=C4)C[C@@]1([H])N(CC=C)CC5.OC(C(O)=O)=O |
| Size | 10 mM * 1 mL |
| Supplier Page | https://www.medchemexpress.com/Naloxegol-oxalate.html |
