Naphthol AS-BI N-acetyl-β-D-glucosaminide | MedChemExpress (MCE)
Naphthol AS-BI N-acetyl-β-D-glucosaminide acts as a substrate and reacts directly with N-acetyl-β-glucosaminidase enzyme. Naphthol AS-BI N-acetyl-β-D-glucosaminide can detect and localize the active region of N-acetyl-β-glucosaminidase enzyme visually[1].
| Trivial name | Naphthol AS-BI N-acetyl-β-D-glucosaminide |
| Catalog Number | HY-137854 |
| Research Area | Others |
| CAS# | 3395-37-7 |
| Purity | ≥98.0% |
| SMILES | COC(C=CC=C1)=C1NC(C2=CC(C=C(C=C3)Br)=C3C=C2O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)NC(C)=O)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/naphthol-as-bi-n-acetyl-β-d-glucosaminide.html |
