2,3,5-Tri-O-benzyl-D-ribose | MedChemExpress (MCE)
2,3,5-Tri-O-benzyl-D-ribose (Compound 1) is an effective inhibitor of Botrytis cinerea chitin synthase (CHS) with an IC50 value of 1.8 μM. 2,3,5-Tri-O-benzyl-D-ribose exhibits antifungal activity and is able to inhibit the B. cinerea BD90 strain, with a MIC value of 190 μM[1].
| Trivial name | 2,3,5-Tri-O-benzyl-D-ribose |
| Catalog Number | HY-W037200 |
| Alternative Name(s) | 2,3,5-Tri-O-benzyl-D-ribofuranose |
| Research Area | Infection |
| CAS# | 54623-25-5 |
| Purity | ≥98.0% |
| SMILES | O=C[C@H](OCC1=CC=CC=C1)[C@@H]([C@H](O)COCC2=CC=CC=C2)OCC3=CC=CC=C3 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/2-3-5-tri-o-benzyl-d-ribose.html |