Coenzyme Q8 | MedChemExpress (MCE)
Coenzyme Q8 (Ubiquinone 8) is an isoprenoid quinone that mediates electron transfer within the aerobic respiratory chain and mitigates oxidative stress. Coenzyme Q8 enhances nonspecific resistance to bacterial infections[1].
| Trivial name | Coenzyme Q8 |
| Catalog Number | HY-N9680 |
| Alternative Name(s) | Ubiquinone 8 |
| Research Area | Metabolic Disease |
| CAS# | 2394-68-5 |
| Purity | ≥98.0% |
| SMILES | C/C(C)=C\CC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CC(C(C(OC)=C1OC)=O)=C(C)C1=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/coenzyme-q8.html |