Chlorendic acid | MedChemExpress (MCE)
Chlorendic acid (HET acid) can be used as a diacid component for the synthesis of oligoesters with potential flame retardant properties with aliphatic diols. Degradation by chlorine radicals may be responsible for the flame retardancy of HET acid-based oligoesters[1].
| Trivial name | Chlorendic acid |
| Catalog Number | HY-127074 |
| Alternative Name(s) | HET acid |
| Research Area | Others |
| CAS# | 115-28-6 |
| Purity | 99.8% |
| SMILES | OC(C1[C@](Cl)(C2(Cl)Cl)C(Cl)=C(Cl)[C@]2(Cl)[C@H]1C(O)=O)=O |
| Size | 1 g |
| Supplier Page | https://www.medchemexpress.com/chlorendic-acid.html |