Anticancer agent 198 | MedChemExpress (MCE)
Anticancer agent 198 (compound 18b) is a potent anticancer agent and potential WRN protein inhibitor. Anticancer agent 198 was significantly toxic to K562 cells and WRN-overexpressing PC3 cells[1].
| Trivial name | Anticancer agent 198 |
| Catalog Number | HY-158025 |
| Research Area | Cancer |
| Purity | ≥98.0% |
| SMILES | COC1=CC=CC(C(F)(C2=NC3=CC=CC=C3C(N(C4=CC(OC)=C(C=C4)OC)C)=N2)F)=C1 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/anticancer-agent-198.html |