Benzo-18-crown-6-ether | MedChemExpress (MCE)
Benzo-18-crown-6-ether (B18C6) is an organic compound that can be used to prepare stable microcapsule responsive layers for further assembly into bilayer microcapsules. For example, 18-Crown-6-ether is used to prepare the response layer and is coated with a G-quadruplex cross-linked hydrogel layer stabilized by K+; when Mg2+ ions are present, 18-Crown-6-ether and K+ ions can respectively Dissociates and locks with the G-quadruplex cross-linked layer, thereby achieving switchable controlled release of the load[1].
| Trivial name | Benzo-18-crown-6-ether | 
| Catalog Number | HY-W103245 | 
| Alternative Name(s) | B18C6 | 
| Research Area | Others | 
| CAS# | 14098-24-9 | 
| Purity | ≥98.0% | 
| SMILES | C1=CC=C2C(=C1)OCCOCCOCCOCCOCCO2 | 
| Size | 1 g | 
| Supplier Page | https://www.medchemexpress.com/benzo-18-crown-6-ether.html | 
                    