Lenaldekar | MedChemExpress (MCE)
Lenaldekar (LDK) inhibits human and murine T-cell expansiomn. Lenaldekar inhibits autoimmune T cell response. Lenaldekar also induces cancer cell apoptosis. Lenaldekar can be used for T-cell mediated autoimmune diseases research[1][2].
| Trivial name | Lenaldekar |
| Catalog Number | HY-121662 |
| Alternative Name(s) | LDK |
| Research Area | Inflammation/Immunology; Cancer |
| CAS# | 418800-15-4 |
| Purity | ≥98.0% |
| SMILES | C1(/C=N/NC2=C3N=CC=CC3=CC=C2)=CNC4=C1C=CC=C4 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/lenaldekar.html |