NMD670 | MedChemExpress (MCE)
NMD670 is an orally active partial inhibitor of the skeletal muscle-specific chloride channel ClC-1. NMD670 increases muscle excitability in response to movement commands, enhances neuromuscular transmission, restores muscle function and improves muscle mobility. NMD670 has a favorable safety profile and improves muscle function in rats in a MG rat model[1].
| Trivial name | NMD670 |
| Catalog Number | HY-158183 |
| Research Area | Others |
| CAS# | 2354321-33-6 |
| Purity | ≥98.0% |
| SMILES | OC([C@H](C)OC1=CC=C(Br)C=C1C2=NOC=C2)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/nmd670.html |