4-(4-Fluorophenyl)benzoic acid | MedChemExpress (MCE)
4-(4-Fluorophenyl)benzoic acid (Compoud 6) can bind to Bcl-2 with a KD value of 400 μM. 4-(4-Fluorophenyl)benzoic acid can be used to develope Bcl-2 selective anti-cancer agent[1].
| Trivial name | 4-(4-Fluorophenyl)benzoic acid |
| Catalog Number | HY-109617 |
| Research Area | Cancer |
| CAS# | 5731-10-2 |
| Purity | 99.0% |
| SMILES | O=C(C1=CC=C(C2=CC=C(F)C=C2)C=C1)O |
| Size | 25 mg |
| Supplier Page | https://www.medchemexpress.com/4-4-fluorophenyl-benzoic-acid.html |