TTA-A8 | MedChemExpress (MCE)
TTA-A8 (Compound 13) is a short-acting T-type calcium channel antagonist with oral activity, exhibiting an IC50 value of 31.3 nM in the FLIPR depolarization assay. TTA-A8 possesses favorable pharmacokinetic properties, making it suitable for research on epilepsy and sleep[1].
| Trivial name | TTA-A8 |
| Catalog Number | HY-14232 |
| Research Area | Neurological Disease |
| CAS# | 1146395-46-1 |
| Purity | ≥98.0% |
| SMILES | CC1=NC=CN=C1C2=CC=C(C=C2)CC(N[C@@H](C3=CC=C(C=N3)OCC(F)(F)F)C)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/tta-a8.html |